C10H11N3O3 — CID 83968850
3-([1,3]dioxolo[4,5-f]benzotriazol-2-yl)propan-1-ol (PubChem CID 83968850) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 3-([1,3]dioxolo[4,5-f]benzotriazol-2-yl)propan-1-ol.
| Compound Name | 3-([1,3]dioxolo[4,5-f]benzotriazol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 83968850 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 3-([1,3]dioxolo[4,5-f]benzotriazol-2-yl)propan-1-ol |
| SMILES | OCCCn1nc2cc3c(cc2n1)OCO3 |
| InChI | InChI=1S/C10H11N3O3/c14-3-1-2-13-11-7-4-9-10(16-6-15-9)5-8(7)12-13/h4-5,14H,1-3,6H2 |
| InChIKey | XKMPDEGRYNVIQX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |