C12H14N2O3S — CID 84617351
3-[(7-methyl-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)sulfanyl]propan-1-ol (PubChem CID 84617351) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3-[(7-methyl-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)sulfanyl]propan-1-ol.
| Compound Name | 3-[(7-methyl-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 84617351 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-[(7-methyl-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)sulfanyl]propan-1-ol |
| SMILES | Cn1c(SCCCO)nc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C12H14N2O3S/c1-14-9-6-11-10(16-7-17-11)5-8(9)13-12(14)18-4-2-3-15/h5-6,15H,2-4,7H2,1H3 |
| InChIKey | UOSAANFDWHLENE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|