About 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol
3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol (PubChem CID 82149592) has the molecular formula C16H22N2O3
and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol |
| PubChem CID | 82149592 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol |
| SMILES | CCC(CC)c1nc2cc3c(cc2n1CCCO)OCO3 |
| InChI | InChI=1S/C16H22N2O3/c1-3-11(4-2)16-17-12-8-14-15(21-10-20-14)9-13(12)18(16)6-5-7-19/h8-9,11,19H,3-7,10H2,1-2H3 |
| InChIKey | VWUMHUXOWRIYBQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol?
The IUPAC name of 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol (CID 82149592) is 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol.
What is the SMILES notation for 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol?
The canonical SMILES for 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol is CCC(CC)c1nc2cc3c(cc2n1CCCO)OCO3.
What is the InChIKey of 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol?
The InChIKey is VWUMHUXOWRIYBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O3/c1-3-11(4-2)16-17-12-8-14-15(21-10-20-14)9-13(12)18(16)6-5-7-19/h8-9,11,19H,3-7,10H2,1-2H3.
What are the key properties of 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol?
3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol has a molecular weight of 290.36 g/mol, XLogP of 3.05, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol is sourced from PubChem (CID 82149592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).