C15H20N2O3 — CID 82149589
3-(6-butyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol (PubChem CID 82149589) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-(6-butyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol.
| Compound Name | 3-(6-butyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol |
|---|---|
| PubChem CID | 82149589 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 3-(6-butyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propan-1-ol |
| SMILES | CCCCc1nc2cc3c(cc2n1CCCO)OCO3 |
| InChI | InChI=1S/C15H20N2O3/c1-2-3-5-15-16-11-8-13-14(20-10-19-13)9-12(11)17(15)6-4-7-18/h8-9,18H,2-7,10H2,1H3 |
| InChIKey | LETJAFNYDSQZMU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |