C15H18N2O4 — CID 82150191
5-(6-ethyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)pentanoic acid (PubChem CID 82150191) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 5-(6-ethyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)pentanoic acid.
| Compound Name | 5-(6-ethyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)pentanoic acid |
|---|---|
| PubChem CID | 82150191 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5-(6-ethyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)pentanoic acid |
| SMILES | CCc1nc2cc3c(cc2n1CCCCC(=O)O)OCO3 |
| InChI | InChI=1S/C15H18N2O4/c1-2-14-16-10-7-12-13(21-9-20-12)8-11(10)17(14)6-4-3-5-15(18)19/h7-8H,2-6,9H2,1H3,(H,18,19) |
| InChIKey | AWBDVSRGNLLQSX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|