C15H18F2N2O2 — CID 82150067
4-(2-butyl-5,6-difluorobenzimidazol-1-yl)butanoic acid (PubChem CID 82150067) has the molecular formula C15H18F2N2O2 and a molecular weight of 296.32 g/mol. Its IUPAC name is 4-(2-butyl-5,6-difluorobenzimidazol-1-yl)butanoic acid.
| Compound Name | 4-(2-butyl-5,6-difluorobenzimidazol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 82150067 |
| Molecular Formula | C15H18F2N2O2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-(2-butyl-5,6-difluorobenzimidazol-1-yl)butanoic acid |
| SMILES | CCCCc1nc2cc(F)c(F)cc2n1CCCC(=O)O |
| InChI | InChI=1S/C15H18F2N2O2/c1-2-3-5-14-18-12-8-10(16)11(17)9-13(12)19(14)7-4-6-15(20)21/h8-9H,2-7H2,1H3,(H,20,21) |
| InChIKey | BTVJBXWPYCPSPI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |