C14H16F2N2O3 — CID 79193832
3-[5,6-difluoro-2-(4-hydroxybutyl)benzimidazol-1-yl]propanoic acid (PubChem CID 79193832) has the molecular formula C14H16F2N2O3 and a molecular weight of 298.29 g/mol. Its IUPAC name is 3-[5,6-difluoro-2-(4-hydroxybutyl)benzimidazol-1-yl]propanoic acid.
| Compound Name | 3-[5,6-difluoro-2-(4-hydroxybutyl)benzimidazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 79193832 |
| Molecular Formula | C14H16F2N2O3 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-[5,6-difluoro-2-(4-hydroxybutyl)benzimidazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1c(CCCCO)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C14H16F2N2O3/c15-9-7-11-12(8-10(9)16)18(5-4-14(20)21)13(17-11)3-1-2-6-19/h7-8,19H,1-6H2,(H,20,21) |
| InChIKey | RXIDFSGZSSUPOR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|