3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid

C16H12F2N2O2 — CID 82146187

IUPAC3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid
SMILESO=C(O)CCn1c(-c2ccccc2)nc2cc(F)c(F)cc21
InChIInChI=1S/C16H12F2N2O2/c17-11-8-13-14(9-12(11)18)20(7-6-15(21)22)16(19-13)10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H,21,22)
InChIKeyAXPBZKCUSYNKRX-UHFFFAOYSA-N
MW302.28 g/mol
LogP3.46
Rot. Bonds4

About 3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid

3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid (PubChem CID 82146187) has the molecular formula C16H12F2N2O2 and a molecular weight of 302.28 g/mol. Its IUPAC name is 3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid.

Molecular Properties

Compound Name3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid
PubChem CID82146187
Molecular FormulaC16H12F2N2O2
Molecular Weight302.28 g/mol
Exact Mass302.09
IUPAC Name3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid
SMILESO=C(O)CCn1c(-c2ccccc2)nc2cc(F)c(F)cc21
InChIInChI=1S/C16H12F2N2O2/c17-11-8-13-14(9-12(11)18)20(7-6-15(21)22)16(19-13)10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H,21,22)
InChIKeyAXPBZKCUSYNKRX-UHFFFAOYSA-N
XLogP3.46
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.28
LogP ≤ 53.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid?
The IUPAC name of 3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid (CID 82146187) is 3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid.
What is the SMILES notation for 3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid?
The canonical SMILES for 3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid is O=C(O)CCn1c(-c2ccccc2)nc2cc(F)c(F)cc21.
What is the InChIKey of 3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid?
The InChIKey is AXPBZKCUSYNKRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2N2O2/c17-11-8-13-14(9-12(11)18)20(7-6-15(21)22)16(19-13)10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H,21,22).
What are the key properties of 3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid?
3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid has a molecular weight of 302.28 g/mol, XLogP of 3.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propanoic acid is sourced from PubChem (CID 82146187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).