C14H17N3O2S — CID 82149870
3-(6-propan-2-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propanethioamide (PubChem CID 82149870) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-(6-propan-2-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propanethioamide.
| Compound Name | 3-(6-propan-2-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propanethioamide |
|---|---|
| PubChem CID | 82149870 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-(6-propan-2-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propanethioamide |
| SMILES | CC(C)c1nc2cc3c(cc2n1CCC(N)=S)OCO3 |
| InChI | InChI=1S/C14H17N3O2S/c1-8(2)14-16-9-5-11-12(19-7-18-11)6-10(9)17(14)4-3-13(15)20/h5-6,8H,3-4,7H2,1-2H3,(H2,15,20) |
| InChIKey | PYMQQSCQKSDLNB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|