C12H13N3O2S2 — CID 84617352
3-[(7-methyl-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)sulfanyl]propanethioamide (PubChem CID 84617352) has the molecular formula C12H13N3O2S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-[(7-methyl-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)sulfanyl]propanethioamide.
| Compound Name | 3-[(7-methyl-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)sulfanyl]propanethioamide |
|---|---|
| PubChem CID | 84617352 |
| Molecular Formula | C12H13N3O2S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-[(7-methyl-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)sulfanyl]propanethioamide |
| SMILES | Cn1c(SCCC(N)=S)nc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C12H13N3O2S2/c1-15-8-5-10-9(16-6-17-10)4-7(8)14-12(15)19-3-2-11(13)18/h4-5H,2-3,6H2,1H3,(H2,13,18) |
| InChIKey | UFQDHXCVOYWMPE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|