C14H19N3S2 — CID 84617075
2-methyl-3-(1,5,6-trimethylbenzimidazol-2-yl)sulfanylpropanethioamide (PubChem CID 84617075) has the molecular formula C14H19N3S2 and a molecular weight of 293.46 g/mol. Its IUPAC name is 2-methyl-3-(1,5,6-trimethylbenzimidazol-2-yl)sulfanylpropanethioamide.
| Compound Name | 2-methyl-3-(1,5,6-trimethylbenzimidazol-2-yl)sulfanylpropanethioamide |
|---|---|
| PubChem CID | 84617075 |
| Molecular Formula | C14H19N3S2 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-methyl-3-(1,5,6-trimethylbenzimidazol-2-yl)sulfanylpropanethioamide |
| SMILES | Cc1cc2nc(SCC(C)C(N)=S)n(C)c2cc1C |
| InChI | InChI=1S/C14H19N3S2/c1-8-5-11-12(6-9(8)2)17(4)14(16-11)19-7-10(3)13(15)18/h5-6,10H,7H2,1-4H3,(H2,15,18) |
| InChIKey | ADPDCCGTHATOSE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|