C17H25N3O2 — CID 82145615
4-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)butan-1-amine (PubChem CID 82145615) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)butan-1-amine.
| Compound Name | 4-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)butan-1-amine |
|---|---|
| PubChem CID | 82145615 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 4-(6-pentan-3-yl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)butan-1-amine |
| SMILES | CCC(CC)c1nc2cc3c(cc2n1CCCCN)OCO3 |
| InChI | InChI=1S/C17H25N3O2/c1-3-12(4-2)17-19-13-9-15-16(22-11-21-15)10-14(13)20(17)8-6-5-7-18/h9-10,12H,3-8,11,18H2,1-2H3 |
| InChIKey | UPJMCCCPIBEHEM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|