C13H16N2O2S — CID 111127184
2-(3-hydroxypropylsulfanyl)-3,6-dimethylquinazolin-4-one (PubChem CID 111127184) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-(3-hydroxypropylsulfanyl)-3,6-dimethylquinazolin-4-one.
| Compound Name | 2-(3-hydroxypropylsulfanyl)-3,6-dimethylquinazolin-4-one |
|---|---|
| PubChem CID | 111127184 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(3-hydroxypropylsulfanyl)-3,6-dimethylquinazolin-4-one |
| SMILES | Cc1ccc2nc(SCCCO)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C13H16N2O2S/c1-9-4-5-11-10(8-9)12(17)15(2)13(14-11)18-7-3-6-16/h4-5,8,16H,3,6-7H2,1-2H3 |
| InChIKey | BTFMMNZNPYFAOK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|