C12H13BrN2OS — CID 2981657
6-bromo-3-methyl-2-propylsulfanylquinazolin-4-one (PubChem CID 2981657) has the molecular formula C12H13BrN2OS and a molecular weight of 313.22 g/mol. Its IUPAC name is 6-bromo-3-methyl-2-propylsulfanylquinazolin-4-one.
| Compound Name | 6-bromo-3-methyl-2-propylsulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2981657 |
| Molecular Formula | C12H13BrN2OS |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 6-bromo-3-methyl-2-propylsulfanylquinazolin-4-one |
| SMILES | CCCSc1nc2ccc(Br)cc2c(=O)n1C |
| InChI | InChI=1S/C12H13BrN2OS/c1-3-6-17-12-14-10-5-4-8(13)7-9(10)11(16)15(12)2/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | QDOHAGSQVKTEMJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |