C19H26BrN3O2S — CID 2499094
2-(6-bromo-4-oxo-3-pentylquinazolin-2-yl)sulfanyl-N-tert-butylacetamide (PubChem CID 2499094) has the molecular formula C19H26BrN3O2S and a molecular weight of 440.41 g/mol. Its IUPAC name is 2-(6-bromo-4-oxo-3-pentylquinazolin-2-yl)sulfanyl-N-tert-butylacetamide.
| Compound Name | 2-(6-bromo-4-oxo-3-pentylquinazolin-2-yl)sulfanyl-N-tert-butylacetamide |
|---|---|
| PubChem CID | 2499094 |
| Molecular Formula | C19H26BrN3O2S |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-(6-bromo-4-oxo-3-pentylquinazolin-2-yl)sulfanyl-N-tert-butylacetamide |
| SMILES | CCCCCn1c(SCC(=O)NC(C)(C)C)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C19H26BrN3O2S/c1-5-6-7-10-23-17(25)14-11-13(20)8-9-15(14)21-18(23)26-12-16(24)22-19(2,3)4/h8-9,11H,5-7,10,12H2,1-4H3,(H,22,24) |
| InChIKey | IHHWELOPJWYXFD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|