C22H24BrN3O2S — CID 3494579
N-(3-bromophenyl)-2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanylacetamide (PubChem CID 3494579) has the molecular formula C22H24BrN3O2S and a molecular weight of 474.42 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(3-bromophenyl)-2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3494579 |
| Molecular Formula | C22H24BrN3O2S |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-(3-bromophenyl)-2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
| SMILES | CCCCCCn1c(SCC(=O)Nc2cccc(Br)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H24BrN3O2S/c1-2-3-4-7-13-26-21(28)18-11-5-6-12-19(18)25-22(26)29-15-20(27)24-17-10-8-9-16(23)14-17/h5-6,8-12,14H,2-4,7,13,15H2,1H3,(H,24,27) |
| InChIKey | HTLNFSDDDCKTMG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|