C19H18FN3O3S — CID 2575276
N-(3-fluorophenyl)-2-[3-(3-hydroxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 2575276) has the molecular formula C19H18FN3O3S and a molecular weight of 387.44 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[3-(3-hydroxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(3-fluorophenyl)-2-[3-(3-hydroxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2575276 |
| Molecular Formula | C19H18FN3O3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-(3-fluorophenyl)-2-[3-(3-hydroxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1CCCO)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H18FN3O3S/c20-13-5-3-6-14(11-13)21-17(25)12-27-19-22-16-8-2-1-7-15(16)18(26)23(19)9-4-10-24/h1-3,5-8,11,24H,4,9-10,12H2,(H,21,25) |
| InChIKey | QVALSIYQZAFDPM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |