C20H19F2N3O2S — CID 4006012
2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3,4-difluorophenyl)acetamide (PubChem CID 4006012) has the molecular formula C20H19F2N3O2S and a molecular weight of 403.45 g/mol. Its IUPAC name is 2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 4006012 |
| Molecular Formula | C20H19F2N3O2S |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3,4-difluorophenyl)acetamide |
| SMILES | CCCCn1c(SCC(=O)Nc2ccc(F)c(F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H19F2N3O2S/c1-2-3-10-25-19(27)14-6-4-5-7-17(14)24-20(25)28-12-18(26)23-13-8-9-15(21)16(22)11-13/h4-9,11H,2-3,10,12H2,1H3,(H,23,26) |
| InChIKey | ZIRNRUYNAXRRJV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |