C19H16BrFN4O4S — CID 31845799
2-(6-bromo-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-(2-fluoro-5-nitrophenyl)acetamide (PubChem CID 31845799) has the molecular formula C19H16BrFN4O4S and a molecular weight of 495.33 g/mol. Its IUPAC name is 2-(6-bromo-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-(2-fluoro-5-nitrophenyl)acetamide.
| Compound Name | 2-(6-bromo-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-(2-fluoro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 31845799 |
| Molecular Formula | C19H16BrFN4O4S |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 2-(6-bromo-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-(2-fluoro-5-nitrophenyl)acetamide |
| SMILES | CCCn1c(SCC(=O)Nc2cc([N+](=O)[O-])ccc2F)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C19H16BrFN4O4S/c1-2-7-24-18(27)13-8-11(20)3-6-15(13)23-19(24)30-10-17(26)22-16-9-12(25(28)29)4-5-14(16)21/h3-6,8-9H,2,7,10H2,1H3,(H,22,26) |
| InChIKey | RHAHRXFMUPMTMN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|