C20H21FN4O4S2 — CID 40782023
2-(3-butyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(2-fluoro-5-nitrophenyl)acetamide (PubChem CID 40782023) has the molecular formula C20H21FN4O4S2 and a molecular weight of 464.54 g/mol. Its IUPAC name is 2-(3-butyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(2-fluoro-5-nitrophenyl)acetamide.
| Compound Name | 2-(3-butyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(2-fluoro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 40782023 |
| Molecular Formula | C20H21FN4O4S2 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 2-(3-butyl-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(2-fluoro-5-nitrophenyl)acetamide |
| SMILES | CCCCn1c(SCC(=O)Nc2cc([N+](=O)[O-])ccc2F)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C20H21FN4O4S2/c1-4-5-8-24-19(27)17-11(2)12(3)31-18(17)23-20(24)30-10-16(26)22-15-9-13(25(28)29)6-7-14(15)21/h6-7,9H,4-5,8,10H2,1-3H3,(H,22,26) |
| InChIKey | DGJYEWHRNHSFMK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|