C24H22N4O5S2 — CID 3138503
2-[3-(4-methoxyphenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 3138503) has the molecular formula C24H22N4O5S2 and a molecular weight of 510.60 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[3-(4-methoxyphenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3138503 |
| Molecular Formula | C24H22N4O5S2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | COc1ccc(-n2c(SCC(=O)Nc3ccc([N+](=O)[O-])cc3C)nc3sc(C)c(C)c3c2=O)cc1 |
| InChI | InChI=1S/C24H22N4O5S2/c1-13-11-17(28(31)32)7-10-19(13)25-20(29)12-34-24-26-22-21(14(2)15(3)35-22)23(30)27(24)16-5-8-18(33-4)9-6-16/h5-11H,12H2,1-4H3,(H,25,29) |
| InChIKey | FOBKALLCELSNTK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|