C21H32N4O2S — CID 9375437
N-tert-butyl-2-[3-[3-(diethylamino)propyl]-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 9375437) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is N-tert-butyl-2-[3-[3-(diethylamino)propyl]-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-tert-butyl-2-[3-[3-(diethylamino)propyl]-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 9375437 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-tert-butyl-2-[3-[3-(diethylamino)propyl]-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | CCN(CC)CCCn1c(SCC(=O)NC(C)(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H32N4O2S/c1-6-24(7-2)13-10-14-25-19(27)16-11-8-9-12-17(16)22-20(25)28-15-18(26)23-21(3,4)5/h8-9,11-12H,6-7,10,13-15H2,1-5H3,(H,23,26) |
| InChIKey | UBDBWKNLZPGOGF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |