C22H34N4O2S — CID 40727739
2-[3-[3-(diethylamino)propyl]-4-oxoquinazolin-2-yl]sulfanyl-N-[(2S)-pentan-2-yl]acetamide (PubChem CID 40727739) has the molecular formula C22H34N4O2S and a molecular weight of 418.61 g/mol. Its IUPAC name is 2-[3-[3-(diethylamino)propyl]-4-oxoquinazolin-2-yl]sulfanyl-N-[(2S)-pentan-2-yl]acetamide.
| Compound Name | 2-[3-[3-(diethylamino)propyl]-4-oxoquinazolin-2-yl]sulfanyl-N-[(2S)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 40727739 |
| Molecular Formula | C22H34N4O2S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 2-[3-[3-(diethylamino)propyl]-4-oxoquinazolin-2-yl]sulfanyl-N-[(2S)-pentan-2-yl]acetamide |
| SMILES | CCC[C@H](C)NC(=O)CSc1nc2ccccc2c(=O)n1CCCN(CC)CC |
| InChI | InChI=1S/C22H34N4O2S/c1-5-11-17(4)23-20(27)16-29-22-24-19-13-9-8-12-18(19)21(28)26(22)15-10-14-25(6-2)7-3/h8-9,12-13,17H,5-7,10-11,14-16H2,1-4H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | ZMPGDLLGYVYCEG-KRWDZBQOSA-N |
| XLogP | 3.53 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |