C23H27N3O3S — CID 55366134
2-[3-(3-hydroxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(1-phenylbutyl)acetamide (PubChem CID 55366134) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-[3-(3-hydroxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(1-phenylbutyl)acetamide.
| Compound Name | 2-[3-(3-hydroxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(1-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 55366134 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-[3-(3-hydroxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(1-phenylbutyl)acetamide |
| SMILES | CCCC(NC(=O)CSc1nc2ccccc2c(=O)n1CCCO)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-2-9-19(17-10-4-3-5-11-17)24-21(28)16-30-23-25-20-13-7-6-12-18(20)22(29)26(23)14-8-15-27/h3-7,10-13,19,27H,2,8-9,14-16H2,1H3,(H,24,28) |
| InChIKey | NHANBYSSLCNSBK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |