C18H20N2O2S2 — CID 112778487
5-(3,4-dimethylphenyl)-2-(3-hydroxypropylsulfanyl)-3-methylthieno[2,3-d]pyrimidin-4-one (PubChem CID 112778487) has the molecular formula C18H20N2O2S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-2-(3-hydroxypropylsulfanyl)-3-methylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(3,4-dimethylphenyl)-2-(3-hydroxypropylsulfanyl)-3-methylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 112778487 |
| Molecular Formula | C18H20N2O2S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-2-(3-hydroxypropylsulfanyl)-3-methylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(-c2csc3nc(SCCCO)n(C)c(=O)c23)cc1C |
| InChI | InChI=1S/C18H20N2O2S2/c1-11-5-6-13(9-12(11)2)14-10-24-16-15(14)17(22)20(3)18(19-16)23-8-4-7-21/h5-6,9-10,21H,4,7-8H2,1-3H3 |
| InChIKey | LJRMZAQIQRHAQK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|