C24H22N4O4S2 — CID 46788064
2-[5-(3,4-dimethylphenyl)-3-methyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(2-nitrophenyl)propanamide (PubChem CID 46788064) has the molecular formula C24H22N4O4S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is 2-[5-(3,4-dimethylphenyl)-3-methyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(2-nitrophenyl)propanamide.
| Compound Name | 2-[5-(3,4-dimethylphenyl)-3-methyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 46788064 |
| Molecular Formula | C24H22N4O4S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 2-[5-(3,4-dimethylphenyl)-3-methyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(2-nitrophenyl)propanamide |
| SMILES | Cc1ccc(-c2csc3nc(SC(C)C(=O)Nc4ccccc4[N+](=O)[O-])n(C)c(=O)c23)cc1C |
| InChI | InChI=1S/C24H22N4O4S2/c1-13-9-10-16(11-14(13)2)17-12-33-22-20(17)23(30)27(4)24(26-22)34-15(3)21(29)25-18-7-5-6-8-19(18)28(31)32/h5-12,15H,1-4H3,(H,25,29) |
| InChIKey | YORYKHDAUMHECV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|