C16H14N4O3S — CID 46794291
2-imidazo[1,5-a]pyridin-3-ylsulfanyl-N-(2-nitrophenyl)propanamide (PubChem CID 46794291) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-imidazo[1,5-a]pyridin-3-ylsulfanyl-N-(2-nitrophenyl)propanamide.
| Compound Name | 2-imidazo[1,5-a]pyridin-3-ylsulfanyl-N-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 46794291 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-imidazo[1,5-a]pyridin-3-ylsulfanyl-N-(2-nitrophenyl)propanamide |
| SMILES | CC(Sc1ncc2ccccn12)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N4O3S/c1-11(24-16-17-10-12-6-4-5-9-19(12)16)15(21)18-13-7-2-3-8-14(13)20(22)23/h2-11H,1H3,(H,18,21) |
| InChIKey | UNGLJXWSTSWQJS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|