C19H18N4O2S2 — CID 55752579
3,6-dimethyl-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one (PubChem CID 55752579) has the molecular formula C19H18N4O2S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 3,6-dimethyl-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one.
| Compound Name | 3,6-dimethyl-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 55752579 |
| Molecular Formula | C19H18N4O2S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 3,6-dimethyl-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one |
| SMILES | Cc1ccc2nc(SCCCc3nc(-c4cccs4)no3)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C19H18N4O2S2/c1-12-7-8-14-13(11-12)18(24)23(2)19(20-14)27-10-4-6-16-21-17(22-25-16)15-5-3-9-26-15/h3,5,7-9,11H,4,6,10H2,1-2H3 |
| InChIKey | HIMRTXWEZYCSGI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|