C14H15N5O3S — CID 18201628
5-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propyl]-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 18201628) has the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. Its IUPAC name is 5-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propyl]-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propyl]-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 18201628 |
| Molecular Formula | C14H15N5O3S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 5-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propyl]-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | Cc1nn(CCCc2nc(-c3cccs3)no2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15N5O3S/c1-9-13(19(20)21)10(2)18(16-9)7-3-6-12-15-14(17-22-12)11-5-4-8-23-11/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | FMPKKODZXFDCRZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|