C10H10N2O2S — CID 130369057
4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanal (PubChem CID 130369057) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanal.
| Compound Name | 4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanal |
|---|---|
| PubChem CID | 130369057 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanal |
| SMILES | O=CCCCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C10H10N2O2S/c13-6-2-1-5-9-11-10(12-14-9)8-4-3-7-15-8/h3-4,6-7H,1-2,5H2 |
| InChIKey | QHILJEMCPWPLPQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|