C19H18N4OS2 — CID 47016364
5-[3-[1-(3-methylphenyl)imidazol-2-yl]sulfanylpropyl]-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 47016364) has the molecular formula C19H18N4OS2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 5-[3-[1-(3-methylphenyl)imidazol-2-yl]sulfanylpropyl]-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[3-[1-(3-methylphenyl)imidazol-2-yl]sulfanylpropyl]-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 47016364 |
| Molecular Formula | C19H18N4OS2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 5-[3-[1-(3-methylphenyl)imidazol-2-yl]sulfanylpropyl]-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | Cc1cccc(-n2ccnc2SCCCc2nc(-c3cccs3)no2)c1 |
| InChI | InChI=1S/C19H18N4OS2/c1-14-5-2-6-15(13-14)23-10-9-20-19(23)26-12-4-8-17-21-18(22-24-17)16-7-3-11-25-16/h2-3,5-7,9-11,13H,4,8,12H2,1H3 |
| InChIKey | NCMRPUSICJIMOI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|