C17H16N2O3S2 — CID 34655268
5-[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)propyl]-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 34655268) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 5-[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)propyl]-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)propyl]-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 34655268 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 5-[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)propyl]-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | c1csc(-c2noc(CCCSc3ccc4c(c3)OCCO4)n2)c1 |
| InChI | InChI=1S/C17H16N2O3S2/c1-3-15(24-10-1)17-18-16(22-19-17)4-2-9-23-12-5-6-13-14(11-12)21-8-7-20-13/h1,3,5-6,10-11H,2,4,7-9H2 |
| InChIKey | VGJZZXLQPVAKDZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|