C15H20N6OS2 — CID 35520303
3-tert-butyl-5-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 35520303) has the molecular formula C15H20N6OS2 and a molecular weight of 364.50 g/mol. Its IUPAC name is 3-tert-butyl-5-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-tert-butyl-5-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 35520303 |
| Molecular Formula | C15H20N6OS2 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-tert-butyl-5-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | CC(C)(C)c1nnc(SCCCc2nc(-c3cccs3)no2)n1N |
| InChI | InChI=1S/C15H20N6OS2/c1-15(2,3)13-18-19-14(21(13)16)24-9-5-7-11-17-12(20-22-11)10-6-4-8-23-10/h4,6,8H,5,7,9,16H2,1-3H3 |
| InChIKey | WKSRHRPNQWCIIM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|