C16H15N5O2S3 — CID 18142504
N-(furan-2-ylmethyl)-5-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 18142504) has the molecular formula C16H15N5O2S3 and a molecular weight of 405.53 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(furan-2-ylmethyl)-5-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 18142504 |
| Molecular Formula | C16H15N5O2S3 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | c1coc(CNc2nnc(SCCCc3nc(-c4cccs4)no3)s2)c1 |
| InChI | InChI=1S/C16H15N5O2S3/c1-4-11(22-7-1)10-17-15-19-20-16(26-15)25-9-3-6-13-18-14(21-23-13)12-5-2-8-24-12/h1-2,4-5,7-8H,3,6,9-10H2,(H,17,19) |
| InChIKey | JNDHJEGGVXJYJK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|