C19H17N3O2S2 — CID 55631222
N-(furan-2-ylmethyl)-5-(2-naphthalen-2-yloxyethylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 55631222) has the molecular formula C19H17N3O2S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-(2-naphthalen-2-yloxyethylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(furan-2-ylmethyl)-5-(2-naphthalen-2-yloxyethylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 55631222 |
| Molecular Formula | C19H17N3O2S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-(2-naphthalen-2-yloxyethylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | c1coc(CNc2nnc(SCCOc3ccc4ccccc4c3)s2)c1 |
| InChI | InChI=1S/C19H17N3O2S2/c1-2-5-15-12-16(8-7-14(15)4-1)24-10-11-25-19-22-21-18(26-19)20-13-17-6-3-9-23-17/h1-9,12H,10-11,13H2,(H,20,21) |
| InChIKey | QMRHLLMHWJCBPO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|