C12H14N4O2S2 — CID 51210249
2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-prop-2-enylacetamide (PubChem CID 51210249) has the molecular formula C12H14N4O2S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 51210249 |
| Molecular Formula | C12H14N4O2S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1nnc(NCc2ccco2)s1 |
| InChI | InChI=1S/C12H14N4O2S2/c1-2-5-13-10(17)8-19-12-16-15-11(20-12)14-7-9-4-3-6-18-9/h2-4,6H,1,5,7-8H2,(H,13,17)(H,14,15) |
| InChIKey | XBFDRBNCJYCGER-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|