C16H12Cl2N4O3S2 — CID 2921771
3,4-dichloro-N-[5-[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 2921771) has the molecular formula C16H12Cl2N4O3S2 and a molecular weight of 443.34 g/mol. Its IUPAC name is 3,4-dichloro-N-[5-[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[5-[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 2921771 |
| Molecular Formula | C16H12Cl2N4O3S2 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | 3,4-dichloro-N-[5-[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccc(Cl)c(Cl)c2)s1)NCc1ccco1 |
| InChI | InChI=1S/C16H12Cl2N4O3S2/c17-11-4-3-9(6-12(11)18)14(24)20-15-21-22-16(27-15)26-8-13(23)19-7-10-2-1-5-25-10/h1-6H,7-8H2,(H,19,23)(H,20,21,24) |
| InChIKey | LJZOXAAHOLLQME-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|