C16H15N5O3S2 — CID 40674283
N'-[2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 40674283) has the molecular formula C16H15N5O3S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N'-[2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 40674283 |
| Molecular Formula | C16H15N5O3S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N'-[2-[[5-(furan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSc1nnc(NCc2ccco2)s1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H15N5O3S2/c22-13(18-19-14(23)11-5-2-1-3-6-11)10-25-16-21-20-15(26-16)17-9-12-7-4-8-24-12/h1-8H,9-10H2,(H,17,20)(H,18,22)(H,19,23) |
| InChIKey | VOHJCRNYACJCQM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|