C14H13N5O2S3 — CID 18089658
N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 18089658) has the molecular formula C14H13N5O2S3 and a molecular weight of 379.49 g/mol. Its IUPAC name is N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 18089658 |
| Molecular Formula | C14H13N5O2S3 |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | C=CCSc1nnc(NC(=O)CCc2nc(-c3cccs3)no2)s1 |
| InChI | InChI=1S/C14H13N5O2S3/c1-2-7-23-14-18-17-13(24-14)15-10(20)5-6-11-16-12(19-21-11)9-4-3-8-22-9/h2-4,8H,1,5-7H2,(H,15,17,20) |
| InChIKey | WDKVDDWJGKHOTM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|