C24H20N6O2S — CID 16625332
3-(4-methyl-2-pyridinyl)-2-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one (PubChem CID 16625332) has the molecular formula C24H20N6O2S and a molecular weight of 456.53 g/mol. Its IUPAC name is 3-(4-methyl-2-pyridinyl)-2-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(4-methyl-2-pyridinyl)-2-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 16625332 |
| Molecular Formula | C24H20N6O2S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 3-(4-methyl-2-pyridinyl)-2-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one |
| SMILES | Cc1ccnc(-n2c(SCCCc3nc(-c4ccncc4)no3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C24H20N6O2S/c1-16-8-13-26-20(15-16)30-23(31)18-5-2-3-6-19(18)27-24(30)33-14-4-7-21-28-22(29-32-21)17-9-11-25-12-10-17/h2-3,5-6,8-13,15H,4,7,14H2,1H3 |
| InChIKey | NGMBFSVLVSTRIR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 99.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|