C25H22N6OS — CID 16583321
5-[3-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 16583321) has the molecular formula C25H22N6OS and a molecular weight of 454.56 g/mol. Its IUPAC name is 5-[3-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-[3-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 16583321 |
| Molecular Formula | C25H22N6OS |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 5-[3-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | Cc1ccc(-n2c(SCCCc3nc(-c4ccncc4)no3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N6OS/c1-18-9-11-21(12-10-18)31-24(20-6-3-2-4-7-20)28-29-25(31)33-17-5-8-22-27-23(30-32-22)19-13-15-26-16-14-19/h2-4,6-7,9-16H,5,8,17H2,1H3 |
| InChIKey | QDUUAJSNLBNOJQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|