C17H15N7OS — CID 16583197
5-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 16583197) has the molecular formula C17H15N7OS and a molecular weight of 365.42 g/mol. Its IUPAC name is 5-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 16583197 |
| Molecular Formula | C17H15N7OS |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 5-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | c1ccc(-n2nnnc2SCCCc2nc(-c3ccncc3)no2)cc1 |
| InChI | InChI=1S/C17H15N7OS/c1-2-5-14(6-3-1)24-17(20-22-23-24)26-12-4-7-15-19-16(21-25-15)13-8-10-18-11-9-13/h1-3,5-6,8-11H,4,7,12H2 |
| InChIKey | MHXXTUDBEKFSGR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 95.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|