C18H17N7OS — CID 16583139
5-[3-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylpropyl]-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 16583139) has the molecular formula C18H17N7OS and a molecular weight of 379.45 g/mol. Its IUPAC name is 5-[3-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylpropyl]-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-[3-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylpropyl]-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 16583139 |
| Molecular Formula | C18H17N7OS |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 5-[3-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylpropyl]-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | Cc1ccccc1-n1nnnc1SCCCc1nc(-c2ccncc2)no1 |
| InChI | InChI=1S/C18H17N7OS/c1-13-5-2-3-6-15(13)25-18(21-23-24-25)27-12-4-7-16-20-17(22-26-16)14-8-10-19-11-9-14/h2-3,5-6,8-11H,4,7,12H2,1H3 |
| InChIKey | WZXDHPLORUNVEY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|