C21H19FN6OS — CID 112809516
5-[3-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 112809516) has the molecular formula C21H19FN6OS and a molecular weight of 422.49 g/mol. Its IUPAC name is 5-[3-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-[3-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112809516 |
| Molecular Formula | C21H19FN6OS |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 5-[3-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | C=CCn1c(SCCCc2nc(-c3ccncc3)no2)nnc1-c1ccccc1F |
| InChI | InChI=1S/C21H19FN6OS/c1-2-13-28-20(16-6-3-4-7-17(16)22)25-26-21(28)30-14-5-8-18-24-19(27-29-18)15-9-11-23-12-10-15/h2-4,6-7,9-12H,1,5,8,13-14H2 |
| InChIKey | RKDVCSQCSJBCGW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|