C23H22FN5OS — CID 55529450
3-(3-fluoro-4-methylphenyl)-5-[3-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1,2,4-oxadiazole (PubChem CID 55529450) has the molecular formula C23H22FN5OS and a molecular weight of 435.53 g/mol. Its IUPAC name is 3-(3-fluoro-4-methylphenyl)-5-[3-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1,2,4-oxadiazole.
| Compound Name | 3-(3-fluoro-4-methylphenyl)-5-[3-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55529450 |
| Molecular Formula | C23H22FN5OS |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 3-(3-fluoro-4-methylphenyl)-5-[3-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1,2,4-oxadiazole |
| SMILES | C=CCn1c(SCCCc2nc(-c3ccc(C)c(F)c3)no2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C23H22FN5OS/c1-3-13-29-22(17-8-5-4-6-9-17)26-27-23(29)31-14-7-10-20-25-21(28-30-20)18-12-11-16(2)19(24)15-18/h3-6,8-9,11-12,15H,1,7,10,13-14H2,2H3 |
| InChIKey | UZLYSFCTMRJQKG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|