C21H20FN5O2S — CID 55529469
3-(3-fluoro-4-methylphenyl)-5-[3-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4-oxadiazole (PubChem CID 55529469) has the molecular formula C21H20FN5O2S and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-(3-fluoro-4-methylphenyl)-5-[3-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4-oxadiazole.
| Compound Name | 3-(3-fluoro-4-methylphenyl)-5-[3-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55529469 |
| Molecular Formula | C21H20FN5O2S |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 3-(3-fluoro-4-methylphenyl)-5-[3-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4-oxadiazole |
| SMILES | COc1ccccc1-n1cnnc1SCCCc1nc(-c2ccc(C)c(F)c2)no1 |
| InChI | InChI=1S/C21H20FN5O2S/c1-14-9-10-15(12-16(14)22)20-24-19(29-26-20)8-5-11-30-21-25-23-13-27(21)17-6-3-4-7-18(17)28-2/h3-4,6-7,9-10,12-13H,5,8,11H2,1-2H3 |
| InChIKey | WMNSEHLYZNLGKR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|