C20H17F2N5OS — CID 55529603
3-(3-fluoro-4-methylphenyl)-5-[3-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4-oxadiazole (PubChem CID 55529603) has the molecular formula C20H17F2N5OS and a molecular weight of 413.45 g/mol. Its IUPAC name is 3-(3-fluoro-4-methylphenyl)-5-[3-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4-oxadiazole.
| Compound Name | 3-(3-fluoro-4-methylphenyl)-5-[3-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55529603 |
| Molecular Formula | C20H17F2N5OS |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 3-(3-fluoro-4-methylphenyl)-5-[3-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4-oxadiazole |
| SMILES | Cc1ccc(-c2noc(CCCSc3n[nH]c(-c4ccccc4F)n3)n2)cc1F |
| InChI | InChI=1S/C20H17F2N5OS/c1-12-8-9-13(11-16(12)22)18-23-17(28-27-18)7-4-10-29-20-24-19(25-26-20)14-5-2-3-6-15(14)21/h2-3,5-6,8-9,11H,4,7,10H2,1H3,(H,24,25,26) |
| InChIKey | JRWZQKYSKPHGJC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|