C19H13ClFN3O2S — CID 7398486
6-chloro-4-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one (PubChem CID 7398486) has the molecular formula C19H13ClFN3O2S and a molecular weight of 401.85 g/mol. Its IUPAC name is 6-chloro-4-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 7398486 |
| Molecular Formula | C19H13ClFN3O2S |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 6-chloro-4-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3n[nH]c(-c4ccccc4F)n3)c2cc1Cl |
| InChI | InChI=1S/C19H13ClFN3O2S/c1-10-6-16-13(8-14(10)20)11(7-17(25)26-16)9-27-19-22-18(23-24-19)12-4-2-3-5-15(12)21/h2-8H,9H2,1H3,(H,22,23,24) |
| InChIKey | VJPIOBAYMJYUEX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|