C22H22ClFN2O2 — CID 32721476
6-chloro-4-[[4-[(2-fluorophenyl)methyl]piperazin-1-yl]methyl]-7-methylchromen-2-one (PubChem CID 32721476) has the molecular formula C22H22ClFN2O2 and a molecular weight of 400.88 g/mol. Its IUPAC name is 6-chloro-4-[[4-[(2-fluorophenyl)methyl]piperazin-1-yl]methyl]-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-[[4-[(2-fluorophenyl)methyl]piperazin-1-yl]methyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 32721476 |
| Molecular Formula | C22H22ClFN2O2 |
| Molecular Weight | 400.88 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 6-chloro-4-[[4-[(2-fluorophenyl)methyl]piperazin-1-yl]methyl]-7-methylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3CCN(Cc4ccccc4F)CC3)c2cc1Cl |
| InChI | InChI=1S/C22H22ClFN2O2/c1-15-10-21-18(12-19(15)23)17(11-22(27)28-21)14-26-8-6-25(7-9-26)13-16-4-2-3-5-20(16)24/h2-5,10-12H,6-9,13-14H2,1H3 |
| InChIKey | YSCPFQUTZLTDNH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|