C23H24ClFN2O2 — CID 46367757
4-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]-6-ethylchromen-2-one (PubChem CID 46367757) has the molecular formula C23H24ClFN2O2 and a molecular weight of 414.91 g/mol. Its IUPAC name is 4-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]-6-ethylchromen-2-one.
| Compound Name | 4-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]-6-ethylchromen-2-one |
|---|---|
| PubChem CID | 46367757 |
| Molecular Formula | C23H24ClFN2O2 |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 4-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]-6-ethylchromen-2-one |
| SMILES | CCc1ccc2oc(=O)cc(CN3CCN(Cc4c(F)cccc4Cl)CC3)c2c1 |
| InChI | InChI=1S/C23H24ClFN2O2/c1-2-16-6-7-22-18(12-16)17(13-23(28)29-22)14-26-8-10-27(11-9-26)15-19-20(24)4-3-5-21(19)25/h3-7,12-13H,2,8-11,14-15H2,1H3 |
| InChIKey | LGVFDQSSBRUMJZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|